|
|
| | 4-Methoxycarbonylcubanecarboxylic acid Basic information |
| Product Name: | 4-Methoxycarbonylcubanecarboxylic acid | | Synonyms: | 4-(Methoxycarbonyl)cubane-1-carboxylic acid;8-(methoxycarbonyl)cubane-1-carboxylic acid;Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylicacid, 1-methyl ester;4-Methoxycarbonylcubanecarboxylic acid >=97%;4-(methoxycarbonyl)pentacyclo[4.2.0.0~2,5~.0~3,8~.0~4,7~]oct...;1-Methyl pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-dicarboxylate;(1s,2r,3s,4s,5s,6s,7r,8s)-4-(methoxycarbonyl)cubane-1-carboxylic acid;4-Methoxycarbonylcubanecarboxylic acid | | CAS: | 24539-28-4 | | MF: | C11H10O4 | | MW: | 206.19 | | EINECS: | | | Product Categories: | | | Mol File: | 24539-28-4.mol |  |
| | 4-Methoxycarbonylcubanecarboxylic acid Chemical Properties |
| Melting point | 181°C | | Boiling point | 341.5±42.0 °C(Predicted) | | density | 1.956 | | Fp | 141.4℃ | | storage temp. | Store at room temperature | | form | powder or crystals | | pka | 4.24±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H10O4/c1-15-9(14)11-5-2-6(11)4-7(11)3(5)10(2,4)8(12)13/h2-7H,1H3,(H,12,13) | | InChIKey | ARRJEFLYRAVFJA-UHFFFAOYSA-N | | SMILES | C12(C(OC)=O)C3C4C5(C(O)=O)C3C1C5C42 |
| WGK Germany | WGK 3 | | HS Code | 29172090 | | Storage Class | 11 - Combustible Solids |
| | 4-Methoxycarbonylcubanecarboxylic acid Usage And Synthesis |
| Uses | 4-Methoxycarbonylcubanecarboxylic Acid is a cubane derivative being studied for its potential to act as a benzene bioisostere. | | Uses | 4-Methoxycarbonylcubanecarboxylic acid is a tertiary carboxylic acid that can undergo iododecarboxylation using 1,3-diiodo-5,5-dimethylhydantoin (DIH) as both reaction initiator and iodine source under irradiative conditions. This product was previously listed as BML00136. |
| | 4-Methoxycarbonylcubanecarboxylic acid Preparation Products And Raw materials |
|