|
|
| | Isopicropodophyllone Basic information |
| Product Name: | Isopicropodophyllone | | Synonyms: | Isopicropodophyllone;(5aS)-5a,6,8aβ,9-Tetrahydro-9α-(3,4,5-trimethoxyphenyl)furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxole-5,8-dione;Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxole-5,8-dione, 5a,6,8a,9-tetrahydro-9-(3,4,5-trimethoxyphenyl)-, (5aS,8aR,9R)- | | CAS: | 55515-07-6 | | MF: | C22H20O8 | | MW: | 412.39 | | EINECS: | | | Product Categories: | | | Mol File: | 55515-07-6.mol |  |
| | Isopicropodophyllone Chemical Properties |
| Melting point | 166 °C | | Boiling point | 602.344±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.366±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | InChI | InChI=1S/C22H20O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-19H,8-9H2,1-3H3/t13-,18-,19+/m1/s1 | | InChIKey | ISCQYPPCSYRZOT-ZNOIYHFQSA-N | | SMILES | O1C2=CC3=C(C=C2OC1)C(=O)[C@]1([H])COC(=O)[C@]1([H])[C@@H]3C1=CC(OC)=C(OC)C(OC)=C1 |
| | Isopicropodophyllone Usage And Synthesis |
| Uses | Isopicropodophyllone, a natural compound that can be isolated from leaves of Podophyllum hexandrum, possesses antifungal activity[1]. | | References | [1] Antifungal aryltetralin lignans from leaves of Podophyllum hexandrum. Phytochemistry. Volume 40, Issue 2, September 1995, Pages 427-431. |
| | Isopicropodophyllone Preparation Products And Raw materials |
|