| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-Thiocitrulline Basic information |
| Product Name: | L-Thiocitrulline | | Synonyms: | 2-THIOUREIDO-L-NORVALINE;L-THIOCITRULLINE HCL;N5-AMINOTHIOXOMETHYL-L-ORNITHINE;THIOCITRULLINE;(S)-2-Amino-5-(thioureido)pentanoic acid, N5-Aminothioxomethyl-L-ornithine;2-Thioureido-L-norvaline, N5-Aminothioxomethyl-L-ornithine;L-Ornithine, N5-(aminothioxomethyl)-;Thio-L-citrulline | | CAS: | 156719-37-8 | | MF: | C6H13N3O2S | | MW: | 191.25 | | EINECS: | | | Product Categories: | | | Mol File: | 156719-37-8.mol |  |
| | L-Thiocitrulline Chemical Properties |
| Melting point | approximate 236℃（decomposition） | | Boiling point | 399.821±52.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.331±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | pka | 2.497±0.24(predicted) | | form | solid | | Major Application | peptide synthesis | | InChI | 1S/C6H13N3O2S/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1 | | InChIKey | BKGWACHYAMTLAF-BYPYZUCNSA-N | | SMILES | N[C@@H](CCCNC(N)=S)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | L-Thiocitrulline Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis | | Biochem/physiol Actions | Potent and selective inhibitor of neuronal and endothelial isoforms of nitric oxide synthase. |
| | L-Thiocitrulline Preparation Products And Raw materials |
|