lasiokaurin manufacturers
- Lasiodin
-
- $126.00
-
2026-07-27
- CAS:28957-08-6
- Purity: 99.82%
- Supply Ability: 10g
|
| | lasiokaurin Basic information |
| Product Name: | lasiokaurin | | Synonyms: | NSC 250683;Oridonin 1-acetate;6,7,14-trihydroxy-15-oxo-7,20-epoxykaur-16-en-1-yl acetate;Lasiodin;(14R)-1α-Acetoxy-7α,20-epoxy-6β,7,14-trihydroxykaur-16-en-15-one;Kaur-16-en-15-one, 1-(acetyloxy)-7,20-epoxy-6,7,14-trihydroxy-, (1α,6β,7α,14R)-;Lasiodin,Inhibitor,inhibit;(1S,4aR,5S,6S,6aR,9S,11aS,11bS,14R)-5,6,14-Trihydroxy-4,4-dimethyl-8-methylene-7-oxododecahydro-1H-6,11b-(epoxymethano)-6a,9-methanocyclohepta[a]naphthalen-1-yl acetate | | CAS: | 28957-08-6 | | MF: | C22H30O7 | | MW: | 406.47 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 28957-08-6.mol |  |
| | lasiokaurin Chemical Properties |
| Melting point | 238-239℃ | | Boiling point | 588.005±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.381±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 10.838±0.70(predicted) | | form | Solid | | color | White to off-white | | InChIKey | DJQLJZNVICMJRV-BTZXMRDLNA-N | | SMILES | [C@@]123C(=O)C(=C)[C@]([H])(CC[C@@]1([H])[C@@]14CO[C@]2(O)[C@H]([C@]1([H])C(C)(C)CC[C@@H]4OC(=O)C)O)[C@H]3O |&1:0,5,9,11,14,16,17,24,30,r| |
| | lasiokaurin Usage And Synthesis |
| Uses | Lasiokaurin is a diterpenoid compound isolated from Isodon lasiocarpus[1]. | | Definition | ChEBI: A natural product found in Isodon adenolomus. | | References | [1] FUJITA, et al. Terpenoids. XX. The Structure and Absolute Configuration of Lasiokaurin and Lasiodonin, New Diterpenoids from Isodon lasiocarpus (HAYATA) KUDO. CHEMICAL & PHARMACEUTICAL BULLETIN, 20(8), 1752–1754. |
| | lasiokaurin Preparation Products And Raw materials |
|