| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Di(2-ethylhexyl) ether Basic information |
| Product Name: | Di(2-ethylhexyl) ether | | Synonyms: | OCTYL ETHER;1,1’-oxybis(2-ethyl-hexan;3,3’-[oxybis(methylene)]bis-heptan;3,3’-[oxybis(methylene)]bis-Heptane;Ether, bis(2-ethylhexyl);ether,bis(2-ethylhexyl);Ethylhexyl oxide;2-ETHYLHEXYL ETHER | | CAS: | 10143-60-9 | | MF: | C16H34O | | MW: | 242.44 | | EINECS: | 233-412-6 | | Product Categories: | | | Mol File: | 10143-60-9.mol |  |
| | Di(2-ethylhexyl) ether Chemical Properties |
| Melting point | -7.6°C (estimate) | | Boiling point | 126 °C / 8mmHg | | density | 0,8 g/cm3 | | refractive index | 1.4320-1.4380 | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear Colourless | | InChI | InChI=1S/C6H15N.CH2N4/c1-5(2)7-6(3)4;1-2-4-5-3-1/h5-7H,1-4H3;1H,(H,2,3,4,5) | | InChIKey | YHCCCMIWRBJYHG-UHFFFAOYSA-N | | SMILES | O(CC(CCCC)CC)CC(CCCC)CC | | CAS DataBase Reference | 10143-60-9 | | EPA Substance Registry System | Heptane, 3,3'-[oxybis(methylene)]bis- (10143-60-9) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | RTECS | KN3175000 | | TSCA | TSCA listed | | HS Code | 2909.19.1800 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | Di(2-ethylhexyl) ether Usage And Synthesis |
| Uses | Derivative of Ethylhexyl Oxide over Nafion-H are highly efficient solid perfluoroalkanesulfonic acid catalyst. |
| | Di(2-ethylhexyl) ether Preparation Products And Raw materials |
|