|
|
| | quercetin 3-O-gentobioside Basic information |
| Product Name: | quercetin 3-O-gentobioside | | Synonyms: | quercetin 3-O-gentobioside;3-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-3',4',5,7-tetrahydroxyflavone;3-[[6-O-(β-D-Glucopyranosyl)-β-D-glucopyranosyl]oxy]-3',4',5,7-tetrahydroxyflavone;6''-O-β-D-Glucopyranosylhyperin;Quercetin 3-gentiobioside;3,3',4',5,7-Pentahydroxyflavone 3-gentiobioside;Quercetin 3-O-beta-gentiobioside;2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside | | CAS: | 7431-83-6 | | MF: | C27H30O17 | | MW: | 626.52 | | EINECS: | | | Product Categories: | | | Mol File: | 7431-83-6.mol |  |
| | quercetin 3-O-gentobioside Chemical Properties |
| Melting point | 205-207℃ (chloroform ) | | Boiling point | 1033.2±65.0 °C(Predicted) | | density | 1.89±0.1 g/cm3(Predicted) | | form | Solid | | pka | 6.17±0.40(Predicted) | | color | Light yellow to yellow | | Major Application | food and beverages | | InChIKey | FDRQPMVGJOQVTL-DEFKTLOSSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC[C@H]2O[C@H]([C@@H]([C@H]([C@@H]2O)O)O)Oc3[c](c4c([o]c3c5cc(c(cc5)O)O)cc(cc4O)O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | quercetin 3-O-gentobioside Usage And Synthesis |
| Uses | Quercetin 3-O-β-Gentiobioside is a derivative of Quercetin (Q509500), a flavonoid with anticancer activity. It is a mitochondrial ATPase and phosphodiesterase inhibitor. It Inhibits PI3-kinase activity and slightly inhibits PIP kinase activity. Quercetin has antiproliferative effects on cancer cell lines, | | Definition | ChEBI: Quercetin 3-beta-gentiobioside is a quercetin O-glycoside in which the hydroxy hydrogen at position 3 of quercetin has been replaced by a gentiobiosyl group. It has a role as a Brassica napus metabolite. It is a quercetin O-glycoside, a disaccharide derivative and a tetrahydroxyflavone. It is functionally related to a gentiobiose. |
| | quercetin 3-O-gentobioside Preparation Products And Raw materials |
|