|
|
| | 4-Bromo-benzo[b]thiophene-2-carboxylic acid Basic information |
| Product Name: | 4-Bromo-benzo[b]thiophene-2-carboxylic acid | | Synonyms: | Benzo[b]thiophene-2-carboxylic acid, 4-bromo-;4-Bromobenzothiophene-2-carboxylic acid;4-Bromobenzo[b]thiophene-2-carboxylicaci;4-BROMO-1-BENZOTHIOPHENE-2-CARBOXYLIC ACID;4-Bromo-benzo[b]thiophene-2-carboxylic acid | | CAS: | 5194-37-6 | | MF: | C9H5BrO2S | | MW: | 257.1 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 5194-37-6.mol | ![4-Bromo-benzo[b]thiophene-2-carboxylic acid Structure](CAS/GIF/5194-37-6.gif) |
| | 4-Bromo-benzo[b]thiophene-2-carboxylic acid Chemical Properties |
| Melting point | 265 | | Boiling point | 429.7±25.0 °C(Predicted) | | density | 1.813±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | powder | | pka | 3.27±0.30(Predicted) | | color | White | | InChI | InChI=1S/C9H5BrO2S/c10-6-2-1-3-7-5(6)4-8(13-7)9(11)12/h1-4H,(H,11,12) | | InChIKey | LAYNZUFIYSYHIV-UHFFFAOYSA-N | | SMILES | C12=CC=CC(Br)=C1C=C(C(O)=O)S2 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2934999090 |
| | 4-Bromo-benzo[b]thiophene-2-carboxylic acid Usage And Synthesis |
| Uses | 4-BROMO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID can be used as a key intermediate in the synthesis of
pharmaceuticals. It has potentially biological activity. | | Synthesis | Step 3: (0367) To a 500 mL single neck flask was added ethyl 4-bromo-1-benzothiophene-2-carboxylate (20 g, 70.4 mmol), tetrahydrofuran (120 mL) and water (100 mL). Aqueous 4 N sodium hydroxide (40 mL) was added slowly with stirring, followed by heating the reaction mixture to 70 °C with continuous stirring for 1 hour. After completion of the reaction, the reaction mixture was extracted with ethyl acetate (70 mL x 2). The pH of the aqueous phase was adjusted to 12 with concentrated hydrochloric acid and the precipitated solid was filtered and dried to give 4-bromobenzo[b]thiophene-2-carboxylic acid (16 g, yield: 88%). | | References | [1] Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1984, vol. 23, # 1, p. 38 - 41 [2] Patent: US2017/158680, 2017, A1. Location in patent: Paragraph 0361; 0366; 0367 |
| | 4-Bromo-benzo[b]thiophene-2-carboxylic acid Preparation Products And Raw materials |
|