| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fmoc-Thr(TBDMS)-OH Basic information |
| Product Name: | Fmoc-Thr(TBDMS)-OH | | Synonyms: | (2S,3R)-3-[(tert-butyldimethylsilyl)oxy]-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid;L-Threonine,O-[(1,1-dimethylethyl)dimethylsilyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-;fmoc-o-(tert.-butyldimethylsilyl)-l-threonine;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-O-(T-BUTYL-DIMETHYLSILYL)-L-THREONINE;N-ALPHA-(9-FLUOROENYLMETHYLOXYCARBONYL)-O-(T-BUTYL-DIMETHYLSILYL)-L-THREONINE;(9H-Fluoren-9-yl)MethOxy]Carbonyl Thr(TBDMS)-OH;O-[(1,1-Dimethylethyl)dimethylsilyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-threonine;FMOC-L-THR(TBDMS)-OH | | CAS: | 146346-82-9 | | MF: | C25H33NO5Si | | MW: | 455.62 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 146346-82-9.mol |  |
| | Fmoc-Thr(TBDMS)-OH Chemical Properties |
| Boiling point | 577.2±50.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.38±0.10(Predicted) | | form | powder | | BRN | 5888824 | | Major Application | peptide synthesis | | InChIKey | LQMPINNWAPYALU-ZHRRBRCNSA-N | | SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Thr(TBDMS)-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Thr(TBDMS)-OH Preparation Products And Raw materials |
|