| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (Dansylaminoethyl)-trimethylammonium perchlorate Basic information |
| Product Name: | (Dansylaminoethyl)-trimethylammonium perchlorate | | Synonyms: | DASP Dimethylaminonaphthalene-5-sulfonamidoethyltrimethyl ammonium perchlorate;DNS-chol;DIMETHYLAMINONAPHTHALENE-5-SULFONAMIDO-ETHYLTRIMETHYL AMMONIUM PERCHLORATE;[5-DIMETHYLAMINONAPHTHALENE-1-SULFONAMIDO-ETHYL]TRIMETHYLAMMONIUM PERCHLORATE;(1-DIMETHYLAMINONAPHTHALENE-5-SULFONAMIDOETHYL)-TRIMETHYLAMMONIUM PERCHLORATE;DASP;(Dansylaminoethyl)-trimethylammonium perchlorate | | CAS: | 33423-98-2 | | MF: | C17H26N3O2S.ClO4 | | MW: | 435.92 | | EINECS: | | | Product Categories: | | | Mol File: | 33423-98-2.mol |  |
| | (Dansylaminoethyl)-trimethylammonium perchlorate Chemical Properties |
| storage temp. | -20°C | | form | solid | | InChI | 1S/C17H26N3O2S.ClHO4/c1-19(2)16-10-6-9-15-14(16)8-7-11-17(15)23(21,22)18-12-13-20(3,4)5;2-1(3,4)5/h6-11,18H,12-13H2,1-5H3;(H,2,3,4,5)/q+1;/p-1 | | InChIKey | JALGRPFYCOBGHM-UHFFFAOYSA-M | | SMILES | [O-]Cl(=O)(=O)=O.CN(C)c1cccc2c(cccc12)S(=O)(=O)NCC[N+](C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (Dansylaminoethyl)-trimethylammonium perchlorate Usage And Synthesis |
| Uses | - Used as a guest for multivalent macrocyclic hosts in histone surface recognition
- Dye for fluorescence spectroscopy
| | reaction suitability | reagent type: oxidant |
| | (Dansylaminoethyl)-trimethylammonium perchlorate Preparation Products And Raw materials |
|