|
|
| | L-(+)-threo-2-(N,N-Dimethylamino)-1-(4-nitrophenyl)-1,3-propanediol Basic information |
| Product Name: | L-(+)-threo-2-(N,N-Dimethylamino)-1-(4-nitrophenyl)-1,3-propanediol | | Synonyms: | 1,3-Propanediol, 2-(diMethylaMino)-1-(4-nitrophenyl)-, (1S,2S)-;(1S,2S)-2-(N,N-Dimethylamino)-1-(p-nitrophenyl)-1,3-propanediol;(1S,2S)-2-(Dimethylamino)-1-(4-nitrophenyl)-1,3-propanediol;L-(+)-threo-2-(N,N-Dimethylamino)-1-(4-nitrophenyl)-1,3-propanediol | | CAS: | 18867-44-2 | | MF: | C11H16N2O4 | | MW: | 240.26 | | EINECS: | | | Product Categories: | Aromatic alcohols and diols | | Mol File: | 18867-44-2.mol |  |
| | L-(+)-threo-2-(N,N-Dimethylamino)-1-(4-nitrophenyl)-1,3-propanediol Chemical Properties |
| Boiling point | 418.6±45.0 °C(Predicted) | | density | 1.284±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 12.90±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H16N2O4/c1-12(2)10(7-14)11(15)8-3-5-9(6-4-8)13(16)17/h3-6,10-11,14-15H,7H2,1-2H3/t10-,11-/m0/s1 | | InChIKey | WKFXOUSFZMOKOH-QWRGUYRKSA-N | | SMILES | [C@@H](C1=CC=C([N+]([O-])=O)C=C1)(O)[C@@H](N(C)C)CO |
| | L-(+)-threo-2-(N,N-Dimethylamino)-1-(4-nitrophenyl)-1,3-propanediol Usage And Synthesis |
| | L-(+)-threo-2-(N,N-Dimethylamino)-1-(4-nitrophenyl)-1,3-propanediol Preparation Products And Raw materials |
|