|
|
| | (1S,2S)-(+)-2-Amino-1-phenyl-1,3-propanediol Basic information |
| Product Name: | (1S,2S)-(+)-2-Amino-1-phenyl-1,3-propanediol | | Synonyms: | S-BASE;L-threo-1-Phenyl-2-aMino-1,3-propaned;(1S,2S)-(+)-2-AMino-1-phenyl-1,3-propanediol 97%;LB human cell line;Levo-Amin-odiol;1,3-Propanediol, 2-amino-1-phenyl-, [S-(R*,R*)]-;[1S,2S,(+)]-1-Phenyl-2-amino-1,3-propanediol;(2S,3S)-3-Phenylpropane-2-aMine-1,3-diol | | CAS: | 28143-91-1 | | MF: | C9H13NO2 | | MW: | 167.21 | | EINECS: | 248-867-6 | | Product Categories: | Amino Alcohols (Chiral);Chiral Building Blocks;Asymmetric Synthesis;for Resolution of Acids;Optical Resolution;Synthetic Organic Chemistry;Propanes/propenes;chiral | | Mol File: | 28143-91-1.mol |  |
| | (1S,2S)-(+)-2-Amino-1-phenyl-1,3-propanediol Chemical Properties |
| Melting point | 109-113 °C (lit.) | | alpha | 35 º (c=1, 1N HCl) | | Boiling point | 295.79°C (rough estimate) | | density | 1.1222 (rough estimate) | | refractive index | 26.5 ° (C=1, MeOH) | | storage temp. | 2-8°C | | pka | 11.73±0.45(Predicted) | | form | Crystals or Crystalline Powder | | color | White to yellow | | Optical Rotation | [α]25/D +37°, c = 1 in 1 M HCl | | biological source | human blood | | BRN | 2804071 | | InChI | InChI=1S/C9H13NO2/c10-8(6-11)9(12)7-4-2-1-3-5-7/h1-5,8-9,11-12H,6,10H2/t8-,9-/m0/s1 | | InChIKey | JUCGVCVPNPBJIG-IUCAKERBSA-N | | SMILES | [C@@H](C1=CC=CC=C1)(O)[C@@H](N)CO | | CAS DataBase Reference | 28143-91-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29221985 | | Storage Class | 11 - Combustible Solids |
| | (1S,2S)-(+)-2-Amino-1-phenyl-1,3-propanediol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (1S,2S)-(+)-2-Amino-1-phenyl-1,3-propanediol is a compound belonging to the chiral amino alchohol group which are used as emulsifying agents in dry-cleaning soaps, wax removers, cosmetics, paints and
insecticides. (1S,2S)-(+)-2-Amino-1-phenyl-1,3-propanediol is used in the preparation of potential anticancer agents | | Uses | Asymetric synthesis of chiral 2-oxazolines | | Uses | Precursor to chiral 2-oxazolines. Auxiliary for the preparation of chiral 2-oxazolines from carboxylic acid derivatives. |
| | (1S,2S)-(+)-2-Amino-1-phenyl-1,3-propanediol Preparation Products And Raw materials |
|