| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DESTRUXIN A Basic information |
| Product Name: | DESTRUXIN A | | Synonyms: | N-[N-[(2R)-1-Oxo-2-hydroxy-4-pentenyl]-L-Pro-L-Ile-N-methyl-L-Val-N-methyl-L-Ala-]-β-alanine lactone;N-[N-[(R)-2-Hydroxy-1-oxo-4-pentenyl]-L-Pro-L-Ile-N-methyl-L-Val-N-methyl-L-Ala-]-β-alanine lactone;Destruxin A from Metarrhizium anisopliae;Destruxin A, 98%, from Metarhizium anisopliae;DESTRUXIN A;destruxin A from metarhizium anisopliae;Cyclo[N-methyl-L-alanyl-β-alanyl-(2R)-2-hydroxy-4-pentenoyl-L-prolyl-L-isoleucyl-N-methyl-L-valyl];Destruxin A from Metarrhizium anisopliae >=98% (HPLC) | | CAS: | 6686-70-0 | | MF: | C29H47N5O7 | | MW: | 577.71 | | EINECS: | | | Product Categories: | Apoptosis and Cell Cycle;Cell Cycle;Cell Cycle Regulators | | Mol File: | 6686-70-0.mol |  |
| | DESTRUXIN A Chemical Properties |
| Melting point | 188-189 °C | | Boiling point | 875.6±65.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Acetonitrile: Soluble; DMF: Soluble; DMSO: Soluble | | form | A powder | | pka | 13.53±0.70(Predicted) | | color | White to off-white | | biological source | Metarrhizium anisopliae | | InChIKey | XIYSEKITPHTMJT-UTJJDKHZSA-N | | SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](CC=C)OC(=O)CCNC(=O)[C@H](C)N(C)C(=O)[C@H](C(C)C)N(C)C1=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-48 | | Safety Statements | 26-36-45 | | WGK Germany | 3 | | RTECS | HH1500000 | | HS Code | 2933790090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | DESTRUXIN A Usage And Synthesis |
| Uses | Destruxin A from Metarrhizium anisopliae has been used for immersion and inoculation bioassay in Rhipicephalus (Boophilus) microplus. It has been used as a transport inhibitor in Drosophila melanogaster. | | Biochem/physiol Actions | Destruxin A is a cyclic hexadepsipeptide produced by fungus causing paralysis and death in insects. May suppress the insect immune response. Possesses an inhibitory activity on leukemic cell proliferation, decreasing the number of cells in G2/M phase. It is virustatic against arboviruses. | | in vivo | Destruxin A (injection; 86 μM; single dose) can specifically inhibit the humoral immune response of Drosophila melanogaster, making the flies more susceptible to bacterial infections[3]. |
| | DESTRUXIN A Preparation Products And Raw materials |
|