| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Boc-tryptophan NCA Basic information |
| Product Name: | Boc-tryptophan NCA | | Synonyms: | BOC-TRP-NCA;Boc-L-Trp-N-carboxyanhydride;Boc-Trp-N-carboxyanhydride >=98.0% (CHN);Nα-Boc-L-tryptophan Nα-carboxy anhydride;(S)-tert-Butyl 4-((1H-indol-3-yl)methyl)-2,5-dioxooxazolidine-3-carboxylate;Tert-butyl (S)-4-((1H-indol-3-yl)methyl)-2,5-dioxooxazolidine-3-carboxylate;3-Oxazolidinecarboxylic acid, 4-(1H-indol-3-ylmethyl)-2,5-dioxo-, 1,1-dimethylethyl ester, (S)- (9CI);Boc-Trp-N-carboxyanhydride | | CAS: | 175837-77-1 | | MF: | C17H18N2O5 | | MW: | 330.34 | | EINECS: | | | Product Categories: | | | Mol File: | 175837-77-1.mol |  |
| | Boc-tryptophan NCA Chemical Properties |
| Melting point | 135°C | | Boiling point | 473.7±37.0 °C(Predicted) | | density | 1.366±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-5°C | | pka | 16.88±0.30(Predicted) | | Optical Rotation | [α]20/D +78±5°, c = 1% in THF | | BRN | 7082757 | | Major Application | peptide synthesis | | InChI | 1S/C17H18N2O5/c1-17(2,3)24-16(22)19-13(14(20)23-15(19)21)8-10-9-18-12-7-5-4-6-11(10)12/h4-7,9,13,18H,8H2,1-3H3/t13-/m0/s1 | | InChIKey | WSFZLNNHQNYZNF-ZDUSSCGKSA-N | | SMILES | CC(C)(C)OC(=O)N1C(Cc2c[nH]c3ccccc23)C(=O)OC1=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | Boc-tryptophan NCA Usage And Synthesis |
| Chemical Properties | Faintly beige powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-tryptophan NCA Preparation Products And Raw materials |
|