| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-amino-5-bromopyridine-2-carboxylic acid Basic information |
| Product Name: | 3-amino-5-bromopyridine-2-carboxylic acid | | Synonyms: | 3-amino-5-bromopyridine-2-carboxylic acid;3-Amino-5-bromopyridine-2...;3-AMino-5-broMopyridin-2-carboxylic acid;3-AMino-5-broMopyridine-2-carboxylic;2-Pyridinecarboxylic acid, 3-aMino-5-broMo-;3-amino-5-bromo-2-Pyridinecarboxylic acid;3-Amino 5-Bromo 2-Carboxylic Acid;3-Amino-5-bromopicolinic acid | | CAS: | 870997-85-6 | | MF: | C6H5BrN2O2 | | MW: | 217.02 | | EINECS: | | | Product Categories: | | | Mol File: | 870997-85-6.mol |  |
| | 3-amino-5-bromopyridine-2-carboxylic acid Chemical Properties |
| Melting point | >170°C (dec.) | | Boiling point | 399.0±42.0 °C(Predicted) | | density | 1.909±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.15±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C6H5BrN2O2/c7-3-1-4(8)5(6(10)11)9-2-3/h1-2H,8H2,(H,10,11) | | InChIKey | GXXIHPZAIYKHGG-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC=C(Br)C=C1N |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 3-amino-5-bromopyridine-2-carboxylic acid Usage And Synthesis |
| Uses | 3-amino-5-bromopyridine-2-carboxylic acid is used in the preparation of biological reagents such as macrocyclic glucagon-like peptide 1 receptor agonists. It is also used in the preparation of pyridinamide and indoline compounds. | | Synthesis | Step 2: Synthesis of 3-amino-5-bromopyridine-2-carboxylic acid
To a 100 mL round bottom flask was added 3-amino-5-bromopyridine-2-carboxamide (1.05 g, 4.9 mmol) and aqueous sodium hydroxide solution (0.98 g dissolved in 10 mL of water, 24.5 mmol). The reaction mixture was heated to reflux temperature and stirred for 5 hours. Upon completion of the reaction, volatiles were removed by distillation under reduced pressure to give a residue. The residue was neutralized with 2N HCl at 0 °C to pH=7.0 and precipitate was precipitated. The precipitate was collected by filtration and dried to give 3-amino-5-bromopyridine-2-carboxylic acid as a light yellow solid (1 g, 95% yield).
1H NMR (300 MHz, DMSO-d6): δ 7.65 (d, J=2.1 Hz, 1H), 7.20 (d, J=2.1 Hz, 1H), 7.01-7.16 (br s, 2H).
LC-MS (ESI): calculated: 215.9; measured: 217.0 [M+H]+ (RT: 0.43 min). | | References | [1] Patent: WO2012/58671, 2012, A1. Location in patent: Page/Page column 117-118
[2] Patent: US2014/38952, 2014, A1. Location in patent: Page/Page column 0180-0181
[3] Patent: EP1757594, 2007, A1. Location in patent: Page/Page column 77
[4] Patent: WO2008/76425, 2008, A1. Location in patent: Page/Page column 33
[5] Patent: WO2008/130600, 2008, A2. Location in patent: Page/Page column 56 |
| | 3-amino-5-bromopyridine-2-carboxylic acid Preparation Products And Raw materials |
|