|
|
| | 7-oxocholest-5-en-3-beta-yl acetate Basic information |
| | 7-oxocholest-5-en-3-beta-yl acetate Chemical Properties |
| Melting point | 157-158 °C | | Boiling point | 526.9±39.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly, Sonicated), Methanol (Slightly, Heated) | | form | Solid | | color | White to Light Yellow | | InChIKey | PMBSWZWCNKVWLV-MTSWCIIENA-N | | SMILES | O=C1C=C2C[C@@H](OC(=O)C)CC[C@]2(C)[C@@]2([H])CC[C@@]3([C@@]([H])([C@H](C)CCCC(C)C)CC[C@@]3([H])[C@]12[H])C |&1:5,12,14,18,19,21,31,33,r| |
| | 7-oxocholest-5-en-3-beta-yl acetate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Intermediate in the preparation of various Cholesterol derivatives and metabolites. |
| | 7-oxocholest-5-en-3-beta-yl acetate Preparation Products And Raw materials |
| Preparation Products | (7R,8S,9S,10R,13R,14S,17R)-7-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one-->LATHOSTEROL |
|