|
|
| | 3'-(Trifluoromethyl)acetophenone oxime Basic information |
| Product Name: | 3'-(Trifluoromethyl)acetophenone oxime | | Synonyms: | 3-(TRIFLUOROMETHYL)ACETOPHENONE OXIME;1-(Trifluormethylphenyl)ethanonoxim);1-[3-(trifluoromethyl)phenyl]ethan-1-one oxime;Ethanone, 1-(3-(trifluoromethyl)phenyl)-, oxime;(3E)-3-(N-hydroxyiMino)-1-[3-(trifluoroMethyl)phenyl]propan-1-one;1-[3-(trifluoroMethyl)phenyl]ethanone oxiMe;1-(3-(trifluoromethyl)phenyl)ethanone oxim;N-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydroxylamine | | CAS: | 99705-50-7 | | MF: | C9H8F3NO | | MW: | 203.16 | | EINECS: | | | Product Categories: | | | Mol File: | 99705-50-7.mol |  |
| | 3'-(Trifluoromethyl)acetophenone oxime Chemical Properties |
| Melting point | 83-86°C | | Boiling point | 255.4±40.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | 11.14±0.70(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C9H8F3NO/c1-6(13-14)7-3-2-4-8(5-7)9(10,11)12/h2-5,14H,1H3 | | InChIKey | QQGVWMIRCZEUBB-UHFFFAOYSA-N | | SMILES | C(=NO)(C1=CC=CC(C(F)(F)F)=C1)C | | EPA Substance Registry System | Ethanone, 1-[3-(trifluoromethyl)phenyl]-, oxime (99705-50-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 2926907090 |
| | 3'-(Trifluoromethyl)acetophenone oxime Usage And Synthesis |
| Uses | m-(Trifluoromethyl)acetophenone Oxime is a reactant in the synthesis of Trifloxystrobin (T778900) which is a broad-spectrum foliar fungicide used in plant protection. |
| | 3'-(Trifluoromethyl)acetophenone oxime Preparation Products And Raw materials |
|