| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-8(15)-Cedren-9-ol Basic information |
| Product Name: | (+)-8(15)-Cedren-9-ol | | Synonyms: | (1R,2R,5S,7R,9S)-8-METHYLENE-2,6,6-TRIMETHYLTRICYCLO[5.3.1.0(1.5)]UNDECAN-9-OL;(3R,3aR,5S,8aS)-3,8,8-Trimethyl-6-methyleneoctahydro-1H-3a,7-methanoazulen-5-ol;cedren-8(15)-en-9α-ol;(+)-8(15)-Cedren-9-ol purum, >=98.0% (sum of enantiomers, GC);1H-3a,7-Methanoazulen-5-ol, octahydro-3,8,8-trimethyl-6-methylene-, (3R,3aR,5S,7R,8aS)-;(+)-8(15)-Cedren-9-ol;(+)-8(15)-Cedren-9-ol | | CAS: | 13567-41-4 | | MF: | C15H24O | | MW: | 220.35 | | EINECS: | | | Product Categories: | | | Mol File: | 13567-41-4.mol |  |
| | (+)-8(15)-Cedren-9-ol Chemical Properties |
| Melting point | 128-130 °C | | Boiling point | 289.1±8.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.86±0.60(Predicted) | | form | solid | | Optical Rotation | [α]20/D +10±1°, c = 5% in chloroform | | InChI | 1S/C15H24O/c1-9-5-6-13-14(3,4)11-7-15(9,13)8-12(16)10(11)2/h9,11-13,16H,2,5-8H2,1,3-4H3/t9-,11-,12+,13+,15-/m1/s1 | | InChIKey | DJYWGTBEZVORGE-GOGITYCRSA-N | | SMILES | [H][C@@]12C[C@@]3(C[C@H](O)C1=C)[C@H](C)CC[C@@]3([H])C2(C)C |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | (+)-8(15)-Cedren-9-ol Usage And Synthesis |
| | (+)-8(15)-Cedren-9-ol Preparation Products And Raw materials |
|