(+)-BETA-CEDRENE manufacturers
- (+)-BETA-CEDRENE
-
- $7.00 / 1KG
-
2020-01-01
- CAS: 546-28-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | (+)-BETA-CEDRENE Basic information |
| Product Name: | (+)-BETA-CEDRENE | | Synonyms: | 1H-3a,7-Methanoazulene, octahydro-3,8,8-trimethyl-6-methylene-, [3R-(3alpha,3abeta,7beta,8aalpha)]-;7-methanoazulene,octahydro-3,8,8-trimethyl-6-methylene-1h-3[3theta-(3alp;BETA-CEDRENE;B-CEDRENE;CEDRENE, B-;[3R-(3alpha,3abeta,7beta,8aalpha)]-octahydro-3,8,8-trimethyl-6-methylene-1H-3a,7-methanoazulene;CEDRENE, B-(SG);B-CEDRENE WITH GC | | CAS: | 546-28-1 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 208-898-8 | | Product Categories: | | | Mol File: | 546-28-1.mol |  |
| | (+)-BETA-CEDRENE Chemical Properties |
| Boiling point | 263-264 °C(lit.) | | density | 0.932 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.502 | | Fp | 113℃ | | storage temp. | 2-8°C | | form | liquid | | Optical Rotation | [α]20/D +13±1°, neat | | BRN | 2244722 | | InChI | 1S/C15H24/c1-10-7-8-15-9-12(10)14(3,4)13(15)6-5-11(15)2/h11-13H,1,5-9H2,2-4H3/t11-,12+,13+,15+/m1/s1 | | InChIKey | DYLPEFGBWGEFBB-OSFYFWSMSA-N | | SMILES | [H][C@]1(C2=C)C(C)(C)[C@@](CC[C@H]3C)([H])[C@]3(CC2)C1 | | LogP | 6.226 (est) | | EPA Substance Registry System | 1H-3a,7-Methanoazulene, octahydro-3,8,8-trimethyl-6-methylene-, (3R,3aS,7S,8aS)- (546-28-1) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 10-23 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | (+)-BETA-CEDRENE Usage And Synthesis |
| Uses | (+)-β-Cedrene has been observed in a Edgeworthia tomentosa (Thunb.) Nakai flower essential oil extract, which has shown to display anitmicrobial properties. | | General Description | β-Cedrene is a tricyclic sesquiterpene obtained from Juniperus cedrus and Juniperus thurifera. It is the main constituent of cedarwood oil, which is used as a raw material for biofuel development. |
| | (+)-BETA-CEDRENE Preparation Products And Raw materials |
|