|
|
| | Benzenemethanamine, 2-chloro-α-methyl-, (αR)- Basic information |
| Product Name: | Benzenemethanamine, 2-chloro-α-methyl-, (αR)- | | Synonyms: | Benzenemethanamine, 2-chloro-α-methyl-, (αR)-;(R)-1-(2-Chlorophenyl)ethylamine;(R)-1-(2-Chlorophenyl)ethanaMine hydrochloride;(R)-1-(2-CHLOROPHENYL)ETHANAMINE-HCl;(R)-2-Chloro-alpha-methylbenzenemethanamine;BenzeneMethanaMine,2-chloro-a-Methyl-, (aR)-;(1R)-1-(2-CHLOROPHENYL)ETHAN-1-AMINE-HCL;(1R)-1-(2-CHLOROPHENYL)ETHAN-1-AMINE | | CAS: | 127733-42-0 | | MF: | C8H10ClN | | MW: | 155.62 | | EINECS: | | | Product Categories: | | | Mol File: | 127733-42-0.mol |  |
| | Benzenemethanamine, 2-chloro-α-methyl-, (αR)- Chemical Properties |
| Boiling point | 217℃ | | density | 1.122 | | Fp | 93℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8.50±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C8H10ClN/c1-6(10)7-4-2-3-5-8(7)9/h2-6H,10H2,1H3/t6-/s3 | | InChIKey | RJPLGQTZHLRZGX-ISZMHOAENA-N | | SMILES | N[C@@H](C1C=CC=CC=1Cl)C |&1:1,r| |
| | Benzenemethanamine, 2-chloro-α-methyl-, (αR)- Usage And Synthesis |
| | Benzenemethanamine, 2-chloro-α-methyl-, (αR)- Preparation Products And Raw materials |
|