| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5-Chloro-2-hydroxybenzophenone Basic information |
| | 5-Chloro-2-hydroxybenzophenone Chemical Properties |
| Melting point | 96-98 °C(lit.) | | Boiling point | 147-149 °C(Press: 0.3 Torr) | | density | 1.307±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 7.49±0.43(Predicted) | | form | Solid | | color | Pale Yellow to Brown | | λmax | 430nm(CH3CN)(lit.) | | Cosmetics Ingredients Functions | UV ABSORBER | | InChI | 1S/C13H9ClO2/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8,15H | | InChIKey | OMWSZDODENFLSV-UHFFFAOYSA-N | | SMILES | Oc1ccc(Cl)cc1C(=O)c2ccccc2 | | LogP | 4.620 (est) | | CAS DataBase Reference | 85-19-8(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Chloro-2-hydroxybenzophenone(85-19-8) |
| | 5-Chloro-2-hydroxybenzophenone Usage And Synthesis |
| Uses | 5-Chloro-2-hydroxybenzophenone is a type of UV filter used in the protection of surfaces sensitive to radiation. Applied in sunscreens and camera lens filters. Potential antibacterial agent. | | Preparation | Preparation by Fries rearrangement of p-chlorophenyl benzoate with aluminium chloride, without solvent, at 180° for 10 min (85%), at 155–157° for 2 h (90%), at 130– 140° for 1 h (72%) or at 100–150° for 0.5–3 h (68%) ; in refluxing chlorobenzene for 4 h (14%). |
| | 5-Chloro-2-hydroxybenzophenone Preparation Products And Raw materials |
|