CYCLOHEXENE SULFIDE manufacturers
- Cyclohexene sulfide
-
- $2.00
-
2026-07-02
- CAS:286-28-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | CYCLOHEXENE SULFIDE Basic information |
| | CYCLOHEXENE SULFIDE Chemical Properties |
| Boiling point | 55-58 °C/12 mmHg (lit.) | | density | 0.941 (estimate) | | refractive index | n20/D 1.527(lit.) | | Fp | 122 °F | | storage temp. | 2-8°C | | form | Opalescent Liquid | | color | Yellow | | InChI | InChI=1S/C6H10S/c1-2-4-6-5(3-1)7-6/h5-6H,1-4H2 | | InChIKey | PQWJNIJNYRPOAA-UHFFFAOYSA-N | | SMILES | C12C(S1)CCCC2 | | CAS DataBase Reference | 286-28-2(CAS DataBase Reference) | | EPA Substance Registry System | 1,2-Epithiocyclohexane (286-28-2) |
| Risk Statements | 10 | | Safety Statements | 16-27-36/37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29309099 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | CYCLOHEXENE SULFIDE Usage And Synthesis |
| Chemical Properties | opalescent yellow liquid | | Synthesis Reference(s) | Journal of the American Chemical Society, 73, p. 3444, 1951 DOI: 10.1021/ja01151a132 Organic Syntheses, Coll. Vol. 4, p. 232, 1963 |
| | CYCLOHEXENE SULFIDE Preparation Products And Raw materials |
|