| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-Methionine-1-13C Basic information |
| | L-Methionine-1-13C Chemical Properties |
| Melting point | 284 °C (dec.) (lit.) | | storage temp. | Store at -20°C | | form | Solid | | color | White to off-white | | Optical Rotation | [α]25/D +23.1°, c = 1 in 1 M HCl | | InChI | 1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/i5+1 | | InChIKey | FFEARJCKVFRZRR-TXZHAAMZSA-N | | SMILES | [H][C@](N)(CCSC)[13C](O)=O | | CAS Number Unlabeled | 63-68-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Methionine-1-13C Usage And Synthesis |
| Uses | L-Methionine-1-13C can be used as L-Methionine-1-13C breath test to assess hepatic regeneration. |
| | L-Methionine-1-13C Preparation Products And Raw materials |
|