| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Boc-Met-OH-1-13C CAS:286437-20-5
|
| Company Name: |
CLEARSYNTH LABS LTD.
|
| Tel: |
+91-22-45045900 |
| Email: |
sales@clearsynth.com |
| Products Intro: |
Product Name:"L-Methionine-13C, N-Boc" CAS:286437-20-5
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | L-METHIONINE-1-13C N-T BOC DERIVATIVE Basic information |
| | L-METHIONINE-1-13C N-T BOC DERIVATIVE Chemical Properties |
| Melting point | 47-50 °C(lit.) | | form | solid | | Major Application | peptide synthesis | | InChI | 1S/C10H19NO4S/c1-10(2,3)15-9(14)11-7(8(12)13)5-6-16-4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m0/s1/i8+1 | | InChIKey | IMUSLIHRIYOHEV-BAZIHRRBSA-N | | SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)[13C](O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-METHIONINE-1-13C N-T BOC DERIVATIVE Usage And Synthesis |
| | L-METHIONINE-1-13C N-T BOC DERIVATIVE Preparation Products And Raw materials |
|