| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
2-Phenyl-1-butene manufacturers
|
| | 2-Phenyl-1-butene Basic information |
| Product Name: | 2-Phenyl-1-butene | | Synonyms: | alpha-Ethylstyrene;Styrene, alpha-ethyl-;(1-Methylenepropyl)benzene;1-(1-Methylenepropyl)benzene;1-Methylenepropylbenzene;but-1-en-2-ylbenzene;Benzene, (1-Methylenepropyl)-;(1-Ethylvinyl)benzene | | CAS: | 2039-93-2 | | MF: | C10H12 | | MW: | 132.2 | | EINECS: | | | Product Categories: | | | Mol File: | 2039-93-2.mol |  |
| | 2-Phenyl-1-butene Chemical Properties |
| Melting point | -41.43°C (estimate) | | Boiling point | 182.05°C | | density | 0.8870 | | refractive index | 1.5264 | | storage temp. | 2-8°C | | Appearance | Colorless to off-white Liquid | | InChI | InChI=1S/C10H12/c1-3-9(2)10-7-5-4-6-8-10/h4-8H,2-3H2,1H3 | | InChIKey | SQHOHKQMTHROSF-UHFFFAOYSA-N | | SMILES | C1(C(=C)CC)=CC=CC=C1 | | CAS DataBase Reference | 2039-93-2 |
| | 2-Phenyl-1-butene Usage And Synthesis |
| | 2-Phenyl-1-butene Preparation Products And Raw materials |
|