|
|
| | 7-Methoxycoumarin-4-acetic acid Basic information |
| | 7-Methoxycoumarin-4-acetic acid Chemical Properties |
| Melting point | 193 °C (dec.)(lit.) | | Boiling point | 472.9±45.0 °C(Predicted) | | density | 1.367±0.06 g/cm3(Predicted) | | Fp | 87°(189°F) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | Soluble in acetone and dimethyl sulfoxide. | | pka | 4.22±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Moisture, Temperature, Light Sensitive | | InChI | InChI=1S/C12H10O5/c1-16-8-2-3-9-7(4-11(13)14)5-12(15)17-10(9)6-8/h2-3,5-6H,4H2,1H3,(H,13,14) | | InChIKey | ZEKAXIFHLIITGV-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(OC)=CC=C2C(CC(O)=O)=C1 | | CAS DataBase Reference | 62935-72-2(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 3204 90 00 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 7-Methoxycoumarin-4-acetic acid Usage And Synthesis |
| Chemical Properties | Light Green Solid | | Uses | Key intermidiate for the synthesis of fluorescence probes in chromatographic detection. Shows local anesthetic activity. | | Uses | 7-Methoxycoumarin-4-acetic acid is a precursor to coumarin-type fluorescent reagents. It has been uses as fluorescent probe in preparation of two novel LysB29 selectively labeled fluorescent derivatives of human insulin, in the preparation of cell-penetrating peptide transportan 10 (tp10) and as fluorescent label for peptides. | | Definition | ChEBI: 7-methoxycoumarin-4-acetic acid is a monocarboxylic acid. It has a role as a fluorochrome. It is functionally related to a coumarin. | | reaction suitability | reagent type: fluorescent-labelling reagent |
| | 7-Methoxycoumarin-4-acetic acid Preparation Products And Raw materials |
|