| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | PHTHALIC-D4 ANHYDRIDE Basic information |
| | PHTHALIC-D4 ANHYDRIDE Chemical Properties |
| Melting point | 131-134 °C (lit.) | | Boiling point | 284 °C (lit.) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Moisture Sensitive | | InChI | 1S/C8H4O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H/i1D,2D,3D,4D | | InChIKey | LGRFSURHDFAFJT-RHQRLBAQSA-N | | SMILES | [2H]c1c([2H])c([2H])c2C(=O)OC(=O)c2c1[2H] | | CAS Number Unlabeled | 85-44-9 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-42/43-41-37/38 | | Safety Statements | 26-36-46-37/39-24/25-23 | | RIDADR | UN 2214 8/PG 3 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | PHTHALIC-D4 ANHYDRIDE Usage And Synthesis |
| Uses | PHTHALIC-D4 ANHYDRIDE, an organic reagent used to synthesize phthalates. | | Uses | Labelled analogue of Phthalic Acid Anhydride, an organic reagent used to synthesize phthalates. |
| | PHTHALIC-D4 ANHYDRIDE Preparation Products And Raw materials |
|