| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | PHTHALIMIDE-15N POTASSIUM SALT Basic information |
| Product Name: | PHTHALIMIDE-15N POTASSIUM SALT | | Synonyms: | POTASSIUM PHTHALIMIDE-15N;PHTHALIMIDE-15N, POTASSIUM DERIVATIVE;PHTHALIMIDE-15N, POTASSIUM DERIVATIVE, 9 9 ATOM % 15N;PHTHALIMIDE-(15)N POTASSIUM SALT, 98 (AT OM % (15)N);1,3-dihydro-1,3-dioxoisoindole-15n;1,3-Dihydro-1,3-dioxoisoindole-15N, Potassium phthalimide-15N;PHTHALIMIDE-15N POTASSIUM SALT;phthalimide potassium- 15N | | CAS: | 53510-88-6 | | MF: | C8H4KNO2 | | MW: | 186.23 | | EINECS: | | | Product Categories: | | | Mol File: | 53510-88-6.mol |  |
| | PHTHALIMIDE-15N POTASSIUM SALT Chemical Properties |
| Melting point | >300 °C(lit.) | | Fp | 150 °C | | storage temp. | Room Temperature, under inert atmosphere | | solubility | Methanol (Slightly), Water | | form | Solid | | color | Off-White to Pale Beige | | BRN | 3639404 | | InChI | 1S/C8H5NO2.K/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H,(H,9,10,11);/q;+1/p-1/i9+1; | | InChIKey | FYRHIOVKTDQVFC-DLBIPZKSSA-M | | SMILES | [K][15N]1C(=O)c2ccccc2C1=O | | CAS Number Unlabeled | 1074-82-4 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | PHTHALIMIDE-15N POTASSIUM SALT Usage And Synthesis |
| Uses | Phthalimide-15N Potassium Salt is N15 labelled derivative of Potassium Phthalimide, which is a green, solid-base organocatalyst. |
| | PHTHALIMIDE-15N POTASSIUM SALT Preparation Products And Raw materials |
|