| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
N-Ethylguanidinium sulfate manufacturers
|
| | N-Ethylguanidinium sulfate Basic information |
| | N-Ethylguanidinium sulfate Chemical Properties |
| Melting point | 244 °C (dec.)(lit.) | | form | solid | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | InChI | InChI=1S/2C3H9N3.H2O4S/c2*1-2-6-3(4)5;1-5(2,3)4/h2*2H2,1H3,(H4,4,5,6);(H2,1,2,3,4) | | InChIKey | UKQVDMIAGTYDFN-UHFFFAOYSA-N | | SMILES | S(O)(O)(=O)=O.C(=N)(N)NCC.C(=N)(N)NCC | | CAS DataBase Reference | 3482-86-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29252900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-Ethylguanidinium sulfate Usage And Synthesis |
| Chemical Properties | White crystals | | Uses | 1-Ethylguanidine sulfate may be used in chemical synthesis studies. |
| | N-Ethylguanidinium sulfate Preparation Products And Raw materials |
|