|
|
| | 2-Methyl-3-(methylthio)furan Basic information |
| | 2-Methyl-3-(methylthio)furan Chemical Properties |
| Boiling point | 132 °C (lit.) | | density | 1.057 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5090(lit.) | | FEMA | 3949 | 2-METHYL-3-(METHYLTHIO)FURAN | | Fp | 59 °C | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | White to Yellow to Green | | Odor | at 10.00 % in triacetin. beefy cheese coffee minty spicy | | Odor Type | sulfurous | | biological source | synthetic | | JECFA Number | 1061 | | Major Application | flavors and fragrances | | InChI | InChI=1S/C6H8OS/c1-5-6(8-2)3-4-7-5/h3-4H,1-2H3 | | InChIKey | OQVAOEIMSKZGAL-UHFFFAOYSA-N | | SMILES | O1C=CC(SC)=C1C | | LogP | 2.33 | | CAS DataBase Reference | 63012-97-5(CAS DataBase Reference) |
| Risk Statements | 10 | | Safety Statements | 24/25 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29321900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 2-Methyl-3-(methylthio)furan Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Chemical Properties | Annual: n/a | | Uses | flavors and fragrances | | Aroma threshold values | Detection: 0.01 ppb. | | General Description | Natural occurrence: Cooked beef and tea. | | Biochem/physiol Actions | Odor at 1.0%. PG. |
| | 2-Methyl-3-(methylthio)furan Preparation Products And Raw materials |
|