| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2,4'-Dichlorobenzophenone Basic information |
| | 2,4'-Dichlorobenzophenone Chemical Properties |
| Melting point | 64°C | | Boiling point | 214 °C / 22mmHg | | density | 1.3930 | | refractive index | 1.5555 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Soluble), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 1959090 | | Henry's Law Constant | 9.2×100 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | InChI | InChI=1S/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H | | InChIKey | YXMYPHLWXBXNFF-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1Cl)(C1=CC=C(Cl)C=C1)=O | | CAS DataBase Reference | 85-29-0(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4'-Dichlorobenzophenone(85-29-0) | | EPA Substance Registry System | Methanone, (2-chlorophenyl)(4-chlorophenyl)- (85-29-0) |
| | 2,4'-Dichlorobenzophenone Usage And Synthesis |
| Chemical Properties | Whitecrystal powder | | Uses | 2,4''-Dichlorobenzophenone is used in the synthesis of triarylcarbinol analogs of fenarimol as potent inhibitors of Trypanosoma cruzi. It can also be used to prepare fatty acid amide hydrolase inhibitors. |
| | 2,4'-Dichlorobenzophenone Preparation Products And Raw materials |
|