|
|
| | Chloro(dodecyl)dimethylsilane Basic information |
| | Chloro(dodecyl)dimethylsilane Chemical Properties |
| Boiling point | 291-293 °C | | density | 0.865 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.445 | | Fp | 110°C | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | Specific Gravity | 0.865 | | color | Colorless to Light yellow to Light orange | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 5240407 | | InChI | InChI=1S/C14H31ClSi/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15/h16H,3-14H2,1-2H3 | | InChIKey | WEJOUFHBSYHICH-UHFFFAOYSA-N | | SMILES | [SiH](CCCCCCCCCCCCCl)(C)C | | CAS DataBase Reference | 66604-31-7 |
| Hazard Codes | C | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2987 8/PG 2 | | WGK Germany | 1 | | F | 10-21 | | TSCA | No | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Chloro(dodecyl)dimethylsilane Usage And Synthesis |
| Chemical Properties | Colorless to Light yellow to Light orange clear liquid | | Uses | Chloro(dodecyl)dimethylsilane is a silicon-based surfactant that can be used as an organic solvent. It has been used in the study of cellulose nanomaterials. |
| | Chloro(dodecyl)dimethylsilane Preparation Products And Raw materials |
|