- Diphenylcarbamyl chloride
-
- $15.00 / 1KG
-
2021-08-12
- CAS:83-01-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Diphenylcarbamyl chloride Basic information |
| | Diphenylcarbamyl chloride Chemical Properties |
| Melting point | 83-85 °C | | Boiling point | 207°C (rough estimate) | | density | 1.1781 (rough estimate) | | refractive index | 1.6330 (estimate) | | storage temp. | 2-8°C | | solubility | organic solvents: soluble | | pka | -4.13±0.50(Predicted) | | form | Crystalline Powder | | color | Beige to gray-green | | Water Solubility | reacts | | Sensitive | Moisture Sensitive | | BRN | 515312 | | InChI | 1S/C13H10ClNO/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H | | InChIKey | XNBKKRFABABBPM-UHFFFAOYSA-N | | SMILES | ClC(=O)N(c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 83-01-2(CAS DataBase Reference) | | NIST Chemistry Reference | Diphenylcarbamoyl chloride(83-01-2) | | EPA Substance Registry System | Carbamic chloride, diphenyl- (83-01-2) |
| Hazard Codes | C | | Risk Statements | 34-43-29 | | Safety Statements | 26-36/37/39-45-28A | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | EY5065000 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29242995 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B
Skin Sens. 1 |
| | Diphenylcarbamyl chloride Usage And Synthesis |
| Chemical Properties | beige to grey-green crystalline powder | | Uses | N,N-Diphenylcarbamyl Chloride (Temozolomide USP Related Compound C) is used in the production of a high performance polyamide used as an electrical switch for memory devices. Also used in the synthesis of modified oligoribonucleotides base pairs. | | Toxicology | The LD50
in rats after a single oral administration is above
2000 mg/kg. It is not irritating to the skin and
eyes but caused sensitization in animal experiments. |
| | Diphenylcarbamyl chloride Preparation Products And Raw materials |
|