|
|
| | Iminodibenzylcarbonyl chloride Basic information |
| Product Name: | Iminodibenzylcarbonyl chloride | | Synonyms: | IMINODIBENZYL CARBONYL CHLORIDE;10,11-DIHYDRO-DIBENZ[B,F]AZEPINE-5-CARBONYL CHLORIDE;10,11-DIHYDRO-5H-DIBENZO[B,F]AZEPINE-5-CARBONYL CHLORIDE;10,11-Dihydro-5H-dibenz[b,f]azepine-5-carbonyl chloride;5-CHLOROCARBONYL-10,11-DIHYDRODIBENZO(B,F)AZEPINE;N-Formyl chloroiminodi benzyl;N-(CHLOROCARBONYL-10,11-DIHYDRO-5H-DIBENZ[B,F]AZEPINECARBAMAZEPINE;2,2'-Iminodibenzyl-5-carbonyl Chloride | | CAS: | 33948-19-5 | | MF: | C15H12ClNO | | MW: | 257.71 | | EINECS: | 251-756-5 | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;(intermediate of carbamazepine) | | Mol File: | 33948-19-5.mol |  |
| | Iminodibenzylcarbonyl chloride Chemical Properties |
| Melting point | 121-124 °C(lit.) | | Boiling point | 397.5±42.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | powder to crystal | | pka | -3.07±0.20(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C15H12ClNO/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-8H,9-10H2 | | InChIKey | COHHZMJBMIHLGF-UHFFFAOYSA-N | | SMILES | C(Cl)(N1C2=CC=CC=C2CCC2=CC=CC=C12)=O | | CAS DataBase Reference | 33948-19-5(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29163990 |
| | Iminodibenzylcarbonyl chloride Usage And Synthesis |
| Chemical Properties | Green Solid | | Uses | Carbamazepine intermediate. | | Synthesis | Iminodibenzylcarbonyl chloride can be prepared in one step from iminodibenzyl and triphosgene. |
| | Iminodibenzylcarbonyl chloride Preparation Products And Raw materials |
|