|
|
| | 2-(3-Carboxyphenyl)propionic acid Basic information |
| Product Name: | 2-(3-Carboxyphenyl)propionic acid | | Synonyms: | 3-(1-carboxyethyl)benzoic acid;Ketoprofen impurity 3/Ketoprofen EP Impurity C/3-(1-carboxyethyl)benzoic acid;Imp. C (EP):3-[(1RS)-1-Carboxyethyl]-benzoic Acid;3-Carboxy-alpha-methylbenzeneacetic acid;DF 2008Y;3-Carboxy-α-methylbenzeneacetic acid;3-Carboxy-α-Methyl-benzeneacetic Acid
(Ketoprofen IMpurity);Ketoprofen Related Compound C (20 mg) (2-(3-carboxyphenyl)propionic acid) | | CAS: | 68432-95-1 | | MF: | C10H10O4 | | MW: | 194.19 | | EINECS: | | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 68432-95-1.mol |  |
| | 2-(3-Carboxyphenyl)propionic acid Chemical Properties |
| Boiling point | 393.6±25.0 °C(Predicted) | | density | 1.324±0.06 g/cm3(Predicted) | | storage temp. | 2-30°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.07±0.10(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C10H10O4/c1-6(9(11)12)7-3-2-4-8(5-7)10(13)14/h2-6H,1H3,(H,11,12)(H,13,14) | | InChIKey | RIXOZEBXQQUHQW-UHFFFAOYSA-N | | SMILES | OC(=O)C(C)c1cc(ccc1)C(=O)O |
| WGK Germany | WGK 3 | | HS Code | 2918992090 | | Storage Class | 11 - Combustible Solids |
| | 2-(3-Carboxyphenyl)propionic acid Usage And Synthesis |
| Uses | 3-Carboxy-α-methylbenzeneacetic Acid (Ketoprofen EP Impurity C) is a impurity of Ketoprofen (K200800). Ketoprofen USP Compound C: (2-(3-Carboxyphenyl)propionic Acid) |
| | 2-(3-Carboxyphenyl)propionic acid Preparation Products And Raw materials |
|