| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 3,4,6-Trimethoxy-1(3H)-isobenzofuranone Basic information |
| Product Name: | 3,4,6-Trimethoxy-1(3H)-isobenzofuranone | | Synonyms: | 3,4,6-TRIMETHOXYPHTHALIDE;3,4,6-TriMethoxy-1(3H)-isobenzofuranone 97%;3,4,6-trimethoxy-3H-2-benzofuran-1-one;1(3H)-Isobenzofuranone, 3,4,6-trimethoxy-;3,4,6-Trimethoxy-1(3H)-isobenzofuranone;3,4,6-Trimethoxy-1(3H)-isobenzofuranone | | CAS: | 189454-29-3 | | MF: | C11H12O5 | | MW: | 224.21 | | EINECS: | | | Product Categories: | | | Mol File: | 189454-29-3.mol |  |
| | 3,4,6-Trimethoxy-1(3H)-isobenzofuranone Chemical Properties |
| Melting point | 149-152 °C (lit.) | | Boiling point | 394.2±42.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | InChI | 1S/C11H12O5/c1-13-6-4-7-9(8(5-6)14-2)11(15-3)16-10(7)12/h4-5,11H,1-3H3 | | InChIKey | JNVLFUCEKYADLU-UHFFFAOYSA-N | | SMILES | COC1OC(=O)c2cc(OC)cc(OC)c12 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 3,4,6-Trimethoxy-1(3H)-isobenzofuranone Usage And Synthesis |
| Uses | 3,4,6-Trimethoxy-1(3H)-isobenzofuranone is also referred to as 3,4,6-trimethoxyphthalide. | | General Description | 3,4,6-Trimethoxy-1(3H)-isobenzofuranone is also referred to as 3,4,6-trimethoxyphthalide. |
| | 3,4,6-Trimethoxy-1(3H)-isobenzofuranone Preparation Products And Raw materials |
|