| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 2,3-Difluorophenylacetic acid Basic information |
| | 2,3-Difluorophenylacetic acid Chemical Properties |
| Melting point | 116-119 °C (lit.) | | Boiling point | 258.1±25.0 °C(Predicted) | | density | 1.373±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.81±0.10(Predicted) | | form | Crystalline Powder | | color | White to off-white | | InChI | InChI=1S/C8H6F2O2/c9-6-3-1-2-5(8(6)10)4-7(11)12/h1-3H,4H2,(H,11,12) | | InChIKey | UXSQXUSJGPVOKT-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC(F)=C1F | | CAS DataBase Reference | 145689-41-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,3-Difluorophenylacetic acid Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2,3-Difluorophenylacetic acid may be used in chemical synthesis. | | Synthesis | Example 19: Synthesis of 2-(2,3-difluorophenyl)acetic acid
Using methyl 2,3-difluorophenylacetate (CAS: 1036273-31-0) as a raw material, the following was performed:
1. 10 mL of water and 0.8 mL of 30% sodium hydroxide solution were added to 0.3 g of methyl 2,3-difluorophenylacetate.
2. the reaction mixture was stirred at 60 °C for 1 h until the reaction was complete.
3. After completion of the reaction, the mixture was acidified to pH=1 with concentrated hydrochloric acid.
4. The product was separated by filtration to afford 2-(2,3-difluorophenyl)acetic acid as a white solid in a yield of 0.2 g (72% yield).
Product Characterization:
1H-NMR (300 MHz, CDCl3): δ (ppm): 3.75 (s, 2H); 7.01-7.06 (m, 3H); 9.4 (bs, 1H). | | References | [1] Patent: WO2008/78350, 2008, A2. Location in patent: Page/Page column 23 |
| | 2,3-Difluorophenylacetic acid Preparation Products And Raw materials |
|