2,3,4,5,6-PENTAFLUOROPHENYLACETIC ACID manufacturers
|
| | 2,3,4,5,6-PENTAFLUOROPHENYLACETIC ACID Basic information |
| Product Name: | 2,3,4,5,6-PENTAFLUOROPHENYLACETIC ACID | | Synonyms: | 2,3,4,5,6-PENTAFLUORPHENYLACETIC ACID;2,3,4,5,6-PENTAFLUOROPHENYLACETIC ACID;PENTAFLUOROPHENYLACETIC ACID;RARECHEM AL BO 0298;Benzeneacetic acid, 2,3,4,5,6-pentafluoro-;2,3,4,5,6-PENTAFLUOROPHENYLACETIC ACID, 98+%;pentaflurobenzalcohol;2,3,4,5,6-Pentafluorobenzeneacetic acid | | CAS: | 653-21-4 | | MF: | C8H3F5O2 | | MW: | 226.1 | | EINECS: | 211-497-0 | | Product Categories: | C8;Carbonyl Compounds;Carboxylic Acids;Aromatic Phenylacetic Acids and Derivatives | | Mol File: | 653-21-4.mol |  |
| | 2,3,4,5,6-PENTAFLUOROPHENYLACETIC ACID Chemical Properties |
| Melting point | 108-110 °C(lit.) | | Boiling point | 235.3±35.0 °C(Predicted) | | density | 1.5096 (estimate) | | storage temp. | Store at room temperature | | solubility | 95% ethanol: soluble50mg/mL, clear, colorless to very faintly yellow | | pka | 3.30±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 2056612 | | InChI | 1S/C8H3F5O2/c9-4-2(1-3(14)15)5(10)7(12)8(13)6(4)11/h1H2,(H,14,15) | | InChIKey | LGCODSNZJOVMHV-UHFFFAOYSA-N | | SMILES | OC(=O)Cc1c(F)c(F)c(F)c(F)c1F | | CAS DataBase Reference | 653-21-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,4,5,6-PENTAFLUOROPHENYLACETIC ACID Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 2,3,4,5,6-Pentafluorophenylacetic acid has been used in the preparation of:
- 2,3,4,5,6-pentafluorophenylacetyl chloride
- 4-bromo-phenacyl-2,3,4,5,6-pentafluorophenyl acetate
| | General Description | FT-IR and FT-Raman spectra of 2,3,4,5,6-pentafluorophenylacetic acid has been studied. |
| | 2,3,4,5,6-PENTAFLUOROPHENYLACETIC ACID Preparation Products And Raw materials |
|