|
|
| | 2-Fluoro-5-nitrophenylboronic acid Basic information |
| Product Name: | 2-Fluoro-5-nitrophenylboronic acid | | Synonyms: | 2-FLUORO-5-NITROBENZENEBORONIC ACID;2-FLUORO-5-NITROPHENYLBORONIC ACID;B-(2-fluoro-5-nitrophenyl)-Boronic acid;5-NITRO-2-FLUOROPHENYLBORONIC ACID;3-Borono-4-fluoronitrobenzene;Boronic acid, B-(2-fluoro-5-nitrophenyl)-;2-Fluoro-5-nitrophenylboronic acid(contains varying amounts of Anhydride);2-Fluoro-5-nitrophenylboronic acid - [F2277] | | CAS: | 819849-20-2 | | MF: | C6H5BFNO4 | | MW: | 184.92 | | EINECS: | | | Product Categories: | Substituted Boronic Acids;Boronic Acid | | Mol File: | 819849-20-2.mol |  |
| | 2-Fluoro-5-nitrophenylboronic acid Chemical Properties |
| Boiling point | 366.8±52.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 6.72±0.58(Predicted) | | form | Powder | | color | White | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C6H5BFNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3,10-11H | | InChIKey | SYAFEPQKPQIRAL-UHFFFAOYSA-N | | SMILES | B(C1=CC([N+]([O-])=O)=CC=C1F)(O)O | | CAS DataBase Reference | 819849-20-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2931900090 |
| | 2-Fluoro-5-nitrophenylboronic acid Usage And Synthesis |
| Uses | 2-Fluoro-5-nitrobenzeneboronic acid is employed as a important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. |
| | 2-Fluoro-5-nitrophenylboronic acid Preparation Products And Raw materials |
|