| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3,2'-Dihydroxychalcone Basic information |
| Product Name: | 3,2'-Dihydroxychalcone | | Synonyms: | 1-(2-Hydroxyphenyl)-3-(3-hydroxyphenyl)-2-propen-1-one;2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)-;Nsc73257;1-(2-HYDROXYPHENYL)-3-(3-HYDROXYPHENYL)PROP-2-EN-1-ONE;3,2'-Dihydroxychalcone;2',3-dihydroxychalcone;3,2′-Dihydroxychalcone;(E)-1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one | | CAS: | 36574-83-1 | | MF: | C15H12O3 | | MW: | 240.25 | | EINECS: | | | Product Categories: | Chalcones | | Mol File: | 36574-83-1.mol |  |
| | 3,2'-Dihydroxychalcone Chemical Properties |
| Melting point | 172 °C(Solvent: Ethanol) | | Boiling point | 466.228±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.287±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 7.733±0.30(predicted) | | form | solid | | InChI | 1S/C15H12O3/c16-12-5-3-4-11(10-12)8-9-15(18)13-6-1-2-7-14(13)17/h1-10,16-17H/b9-8+ | | InChIKey | BLEVPIDFNNFTHJ-CMDGGOBGSA-N | | SMILES | Oc1cccc(\C=C\C(=O)c2ccccc2O)c1 |
| WGK Germany | WGK 3 | | HS Code | 2914390090 | | Storage Class | 11 - Combustible Solids |
| | 3,2'-Dihydroxychalcone Usage And Synthesis |
| | 3,2'-Dihydroxychalcone Preparation Products And Raw materials |
|