| Company Name: |
cjbscvictory Gold |
| Tel: |
13348960310 13348960310 |
| Email: |
3003867561@qq.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2',4'-Dihydroxychalcone manufacturers
|
| | 2',4'-Dihydroxychalcone Basic information |
| Product Name: | 2',4'-Dihydroxychalcone | | Synonyms: | 3-(2,4-DIHYDROXYPHENYL)-ACRYLOPHENONE;2',4'-dihydroxylchalcone;1-(2,4-dihydroxyphenyl)-3-phenyl-2-propen-1-on;1-(2,4-dihydroxyphenyl)-3-phenyl-2-propen-1-one;2’,4’-dihydroxy-chalcon;2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-phenyl-;2',4'-DHC;2',4'DIHYDROXYCHALCONE,2',4' DIHYDROXYCHALCONE | | CAS: | 1776-30-3 | | MF: | C15H12O3 | | MW: | 240.25 | | EINECS: | | | Product Categories: | | | Mol File: | 1776-30-3.mol |  |
| | 2',4'-Dihydroxychalcone Chemical Properties |
| Melting point | 170°C | | Boiling point | 453.5±38.0 °C(Predicted) | | density | 1.286±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder | | pka | 7.42±0.35(Predicted) | | color | Yellow | | InChI | InChI=1S/C15H12O3/c16-12-7-8-13(15(18)10-12)14(17)9-6-11-4-2-1-3-5-11/h1-10,16,18H | | InChIKey | JUMSUVHHUVPSOY-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(O)C=C1O)(=O)C=CC1=CC=CC=C1 |
| | 2',4'-Dihydroxychalcone Usage And Synthesis |
| Uses | anthelmintic, antiulcer, antineoplastic |
| | 2',4'-Dihydroxychalcone Preparation Products And Raw materials |
|