|
|
| | 5-NITRO-M-XYLENE-ALPHA,ALPHA'-DIOL Basic information |
| | 5-NITRO-M-XYLENE-ALPHA,ALPHA'-DIOL Chemical Properties |
| Melting point | 94-96 °C (lit.) | | Boiling point | 421.9±35.0 °C(Predicted) | | density | 1.420 | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 13.45±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C8H9NO4/c10-4-6-1-7(5-11)3-8(2-6)9(12)13/h1-3,10-11H,4-5H2 | | InChIKey | FTLFITNFXXERLN-UHFFFAOYSA-N | | SMILES | C1(CO)=CC([N+]([O-])=O)=CC(CO)=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5-NITRO-M-XYLENE-ALPHA,ALPHA'-DIOL Usage And Synthesis |
| Uses | 5-Nitro-m-xylene-α,α′-diol was used to fabricate chemical sensor for detection of explosive 2,4,6-trinitrotoluene by planar integrated optical waveguide attenuated total reflection spectrometry. |
| | 5-NITRO-M-XYLENE-ALPHA,ALPHA'-DIOL Preparation Products And Raw materials |
|