| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Nitrothal-isopropyl CAS:10552-74-6 Purity:100 μg/ML in Methanol Package:1ML
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:NITROTHAL-ISOPROPYL CAS:10552-74-6 Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
|
| | NITROTHAL-ISOPROPYL Basic information |
| Product Name: | NITROTHAL-ISOPROPYL | | Synonyms: | 3-benzenedicarboxylicacid,5-nitro-bis(1-methylethyl)ester;5-nitro-isophthalicacidiisopropylester;bis(1-methylethyl)5-nitro-1,3-benzenedicarboxylate;KUMULAN;DIISOPROPYL 5-NITROISOPHTHALATE;Nirothale;PALLINAL;NITROTHAL-ISOPROPYL | | CAS: | 10552-74-6 | | MF: | C14H17NO6 | | MW: | 295.29 | | EINECS: | 234-139-5 | | Product Categories: | | | Mol File: | 10552-74-6.mol |  |
| | NITROTHAL-ISOPROPYL Chemical Properties |
| Melting point | 65℃ | | Boiling point | 397.9±22.0 °C(Predicted) | | density | 1.210±0.06 g/cm3(Predicted) | | Fp | 100 °C | | storage temp. | 0-6°C | | Henry's Law Constant | 5.7×102 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture environmental | | InChI | 1S/C14H17NO6/c1-8(2)20-13(16)10-5-11(14(17)21-9(3)4)7-12(6-10)15(18)19/h5-9H,1-4H3 | | InChIKey | VJAWBEFMCIINFU-UHFFFAOYSA-N | | SMILES | CC(C)OC(=O)c1cc(cc(c1)[N+]([O-])=O)C(=O)OC(C)C |
| WGK Germany | 2 | | RTECS | CZ4330000 | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids |
| | NITROTHAL-ISOPROPYL Usage And Synthesis |
| Uses | Nitrothal-isopropyl is a pesticide. | | Definition | ChEBI: Nitrothal-isopropyl is a nitrobenzoic acid, an isopropyl ester and a diester. | | Production Methods | Nitrothal-isopropyl is commercially synthesised through esterification of 5-nitroisophthalic acid with isopropanol. The production process begins with the nitration of isophthalic acid to yield 5-nitroisophthalic acid, which is then purified and reacted with isopropanol in the presence of an acid catalyst, typically sulphuric acid or p-toluenesulfonic acid, to form the diisopropyl ester. This esterification is carried out under reflux conditions to ensure complete conversion and high yield. | | Mechanism of action | Non-systemic with contact action. Inhibits fungal growth but exact mode of action is unclear | | Pesticide Type | Fungicide |
| | NITROTHAL-ISOPROPYL Preparation Products And Raw materials |
|