| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Sarcosine-methyl-d3 Basic information |
| Product Name: | Sarcosine-methyl-d3 | | Synonyms: | FSYKKLYZXJSNPZ-FIBGUPNXSA-N;SARCOSINE-METHYL-D3, 99 ATOM % D;99atom%d;n-methyl-d3-glycine;sarcosine-d3(methyl-d3);Sarcosine-d3 (methyl-d3);D3-Sarcosine;Sarcosine-methyl-d3 | | CAS: | 118685-91-9 | | MF: | C3H4D3NO2 | | MW: | 92.11 | | EINECS: | | | Product Categories: | | | Mol File: | 118685-91-9.mol |  |
| | Sarcosine-methyl-d3 Chemical Properties |
| Melting point | 208 °C (dec.)(lit.) | | solubility | Methanol (Slightly), Water (Sparingly) | | form | Semi-Solid to Sticky Solid | | color | White to Off-White | | InChI | 1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6)/i1D3 | | InChIKey | FSYKKLYZXJSNPZ-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])NCC(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Sarcosine-methyl-d3 Usage And Synthesis |
| Uses | Sarcosine-d3 is the labelled analog of Sarcosine (S140500). Sarcosine is a type1 glycine transporter inhibitor and a glycine agonist that may be useful for treating schizophrenia (1). Sarcosine is also a marker for prostate cancer bioagression (2). Sarcosine-d3 is also an intermediate in the synthesis of Creatinine-d3 (C781502), which is a Labelled Creatinine. The end product of creatine catabolism. Normal constituent of urine. Also found together with creatine in muscle tissues and blood. Occurs in all soils and in grain seeds and other vegetable matter. Has been found in certain fish and in crab meat extract. | | IC 50 | GlyT1 |
| | Sarcosine-methyl-d3 Preparation Products And Raw materials |
|