| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | N-(Carboxymethyl)-N,N,N-trimethyl-d9-ammonium chloride Basic information |
| | N-(Carboxymethyl)-N,N,N-trimethyl-d9-ammonium chloride Chemical Properties |
| Melting point | 241-242 °C (lit.) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C5H11NO2.ClH/c1-6(2,3)4-5(7)8;/h4H2,1-3H3;1H/i1D3,2D3,3D3; | | InChIKey | HOPSCVCBEOCPJZ-KYRNGWDOSA-N | | SMILES | C(C(=O)O)[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 |
| | N-(Carboxymethyl)-N,N,N-trimethyl-d9-ammonium chloride Usage And Synthesis |
| Uses | N-(Carboxymethyl)-N,N,N-trimethyl-d9-ammonium Chloride (CAS# 285979-85-3) is a useful isotopically labeled research compound. |
| | N-(Carboxymethyl)-N,N,N-trimethyl-d9-ammonium chloride Preparation Products And Raw materials |
|