|
|
| | N,N-DIMETHYL-D6-GLYCINE HCL Basic information |
| | N,N-DIMETHYL-D6-GLYCINE HCL Chemical Properties |
| Melting point | 185-188°C | | Boiling point | 190-192 °C(lit.) | | storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Pale Yellow | | Stability: | Hygroscopic | | InChI | 1S/C4H9NO2.ClH/c1-5(2)3-4(6)7;/h3H2,1-2H3,(H,6,7);1H/i1D3,2D3; | | InChIKey | FKASAVXZZLJTNX-TXHXQZCNSA-N | | SMILES | Cl.[2H]C([2H])([2H])N(CC(O)=O)C([2H])([2H])[2H] | | CAS Number Unlabeled | 07/06/2491 |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36/37 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N,N-DIMETHYL-D6-GLYCINE HCL Usage And Synthesis |
| Uses | N,N-di(methyl-d3)glycine Hydrochloride, is the labeled analogue of N,N-Dimethylglycine (D473080), which is a derivative of amino acid Glycine (G615990). Dimethylglycine, has been utilized as an athletic performance enhancer, immunostimulant, and a treatment for autism, epilepsy, or mitochondrial disease. |
| | N,N-DIMETHYL-D6-GLYCINE HCL Preparation Products And Raw materials |
|