(N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE manufacturers
|
| | (N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE Basic information |
| | (N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE Chemical Properties |
| Melting point | 104-106 °C(lit.) | | Boiling point | 360.05°C (rough estimate) | | alpha | +110°(20℃, c=1, CH3OH) | | density | 1.1825 (rough estimate) | | refractive index | 1.5270 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | -2.27±0.40(Predicted) | | Optical Rotation | [α]20/D +110°, c = 1 in methanol | | InChI | 1S/C12H13NO3/c1-9(14)13-11(8-16-12(13)15)7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3/t11-/m0/s1 | | InChIKey | YMVGXIZVSPMNPD-NSHDSACASA-N | | SMILES | CC(=O)N1[C@H](COC1=O)Cc2ccccc2 | | CAS DataBase Reference | 132836-66-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE Usage And Synthesis |
| Chemical Properties | offwhite crystals | | Uses | Versatile chiral auxiliary for asymmetric synthesis. |
| | (N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE Preparation Products And Raw materials |
|