(R)-3-Methylpiperazin-2-one manufacturers
|
| | (R)-3-Methylpiperazin-2-one Basic information |
| Product Name: | (R)-3-Methylpiperazin-2-one | | Synonyms: | 2-Piperazinone, 3-Methyl-, (3R)-;(3R)-3-methylpiperazin-2-one;(R)-3-METHYL-KETOPIPERAZINE;(R)-3-Methyl-2-ketopiperazine;(R)-3-Methylpiperazin-2-one - [M91093];(3R)-3-Methyl-2-piperazinone;(R)-3-METHYL-2-KETOPIPERAZINE;(R)-3-METHYL-2-OXO-PIPERAZINE | | CAS: | 922178-61-8 | | MF: | C5H10N2O | | MW: | 114.15 | | EINECS: | 693-438-2 | | Product Categories: | | | Mol File: | Mol File |  |
| | (R)-3-Methylpiperazin-2-one Chemical Properties |
| Boiling point | 289.6±33.0 °C(Predicted) | | density | 0.992±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 15.51±0.40(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C5H10N2O/c1-4-5(8)7-3-2-6-4/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m1/s1 | | InChIKey | BSPUWRUTIOUGMZ-SCSAIBSYSA-N | | SMILES | N1CCN[C@H](C)C1=O |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 2 | | F | 10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Resp. Sens. 1 |
| | (R)-3-Methylpiperazin-2-one Usage And Synthesis |
| Uses | (R)-3-Methylpiperazin-2-one is a heterocyclic derivative, which can be used as organic synthesis reagent or pharmaceutical intermediate. |
| | (R)-3-Methylpiperazin-2-one Preparation Products And Raw materials |
|