|
|
| | Norfloxacin EP Impurity C Basic information |
| Product Name: | Norfloxacin EP Impurity C | | Synonyms: | Norfloxacin EP Imp C;1-ethyl-4-oxo-6,7-di(piperazin-1-yl)quinoline-3-carboxylic acid;Norfloxacin EP Impurity C (Norfloxacin Dipiperazine Impurity);NorfloxacinEPImpurityCDitrifluoroacetate;1-ethyl-4-oxo-6,7-di(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid;Norfloxacin Impurity C(EP);3-Quinolinecarboxylic acid, 1-ethyl-1,4-dihydro-4-oxo-6,7-di-1-piperazinyl-;Defluoro-6-piperazinyl Norfloxacin | | CAS: | 177554-64-2 | | MF: | C20H27N5O3 | | MW: | 385.46 | | EINECS: | | | Product Categories: | | | Mol File: | 177554-64-2.mol |  |
| | Norfloxacin EP Impurity C Chemical Properties |
| Boiling point | 679.9±55.0 °C(Predicted) | | density | 1.278±0.06 g/cm3(Predicted) | | pka | 6.53±0.41(Predicted) | | InChI | InChI=1S/C20H27N5O3/c1-2-23-13-15(20(27)28)19(26)14-11-17(24-7-3-21-4-8-24)18(12-16(14)23)25-9-5-22-6-10-25/h11-13,21-22H,2-10H2,1H3,(H,27,28) | | InChIKey | NEULWVYSUPNEKQ-UHFFFAOYSA-N | | SMILES | N1(CC)C2=C(C=C(N3CCNCC3)C(N3CCNCC3)=C2)C(=O)C(C(O)=O)=C1 |
| | Norfloxacin EP Impurity C Usage And Synthesis |
| | Norfloxacin EP Impurity C Preparation Products And Raw materials |
|