| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Norfloxacin EP Impurity D Basic information |
| Product Name: | Norfloxacin EP Impurity D | | Synonyms: | Norfloxacin EP Impurity D;Norfloxacin Impurity 4(Norfloxacin EP Impurity D);MBX 2201;1-Ethyl-6-fluoro-7-(piperazin-1-yl);4(1H)-Quinolinone, 1-ethyl-6-fluoro-7-(1-piperazinyl)-;Norfloxacin EP Impurity D (Norfloxacin Descarboxy Impurity);Norfloxacin Descarboxy Impurity;Norfloxacin Impurity D(EP) | | CAS: | 75001-82-0 | | MF: | C15H18FN3O | | MW: | 275.32 | | EINECS: | | | Product Categories: | | | Mol File: | 75001-82-0.mol |  |
| | Norfloxacin EP Impurity D Chemical Properties |
| Melting point | 218.5-220.0 °C | | Boiling point | 470.5±45.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | storage temp. | -10 to -25°C | | pka | 8.68±0.10(Predicted) | | Major Application | pharmaceutical small molecule | | InChIKey | GGLTXLVORITVKE-UHFFFAOYSA-N | | SMILES | O=C1C=CN(CC)C2=C1C=C(F)C(N3CCNCC3)=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Norfloxacin EP Impurity D Usage And Synthesis |
| Uses | These Reference Materials are suitable for use in several analytical applications including, but not limited to, method development for qualitative and quantitative analyses, daily calibration, and routine quality control testing. |
| | Norfloxacin EP Impurity D Preparation Products And Raw materials |
|