| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Norfloxacin impurity 1
CAS:75001-63-7
Purity:99% HPLC Package:5MG;50MG;100MG;500MG;1000MG
|
|
| | Norfloxacin Impurity 2 Basic information |
| Product Name: | Norfloxacin Impurity 2 | | Synonyms: | Norfloxacin Impurity 2;7-amino-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid;Norfloxacin Impurity 12;Norfloxacin EP Impurity 2;Norfloxacin Impurity 2 (7-amino-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid);7-Amino-1-ethyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid (Norfloxacin Impurity);3-Quinolinecarboxylic acid, 7-amino-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-;Norfloxacin impurity Z04 | | CAS: | 75001-63-7 | | MF: | C12H11FN2O3 | | MW: | 250.23 | | EINECS: | | | Product Categories: | impurity | | Mol File: | 75001-63-7.mol |  |
| | Norfloxacin Impurity 2 Chemical Properties |
| solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Pale Green | | InChI | InChI=1S/C12H11FN2O3/c1-2-15-5-7(12(17)18)11(16)6-3-8(13)9(14)4-10(6)15/h3-5H,2,14H2,1H3,(H,17,18) | | InChIKey | VVWOYRFKKIVWJQ-UHFFFAOYSA-N | | SMILES | N1(CC)C2=C(C=C(F)C(N)=C2)C(=O)C(C(O)=O)=C1 |
| | Norfloxacin Impurity 2 Usage And Synthesis |
| Uses | Despiperazine Amino Norfloxacin is an impurity of the antibacterial synthetic drugs Norfloxacin. |
| | Norfloxacin Impurity 2 Preparation Products And Raw materials |
|